C21H24N10O — CID 143973927
N-[5-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-2-(2-methoxyethylamino)phenyl]-N-methanimidoylmethanimidamide (PubChem CID 143973927) has the molecular formula C21H24N10O and a molecular weight of 432.49 g/mol. Its IUPAC name is N-[5-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-2-(2-methoxyethylamino)phenyl]-N-methanimidoylmethanimidamide.
| Compound Name | N-[5-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-2-(2-methoxyethylamino)phenyl]-N-methanimidoylmethanimidamide |
|---|---|
| PubChem CID | 143973927 |
| Molecular Formula | C21H24N10O |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | N-[5-[[3-cyano-8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-2-(2-methoxyethylamino)phenyl]-N-methanimidoylmethanimidamide |
| SMILES | [H]/N=C/N(/C=N/[H])c1cc(Nc2cc(NC3CC3)c3ncc(C#N)n3n2)ccc1NCCOC |
| InChI | InChI=1S/C21H24N10O/c1-32-7-6-25-17-5-4-15(8-19(17)30(12-23)13-24)28-20-9-18(27-14-2-3-14)21-26-11-16(10-22)31(21)29-20/h4-5,8-9,11-14,23-25,27H,2-3,6-7H2,1H3,(H,28,29)/b23-12+,24-13+ |
| InChIKey | VXGLORRDCCMVHO-MPDMMBQKSA-N |
| XLogP | 3.00 |
| TPSA | 150.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|