C13H18F3NO — CID 82994867
3-(3,3-dimethylbutoxy)-5-(trifluoromethyl)aniline (PubChem CID 82994867) has the molecular formula C13H18F3NO and a molecular weight of 261.29 g/mol. Its IUPAC name is 3-(3,3-dimethylbutoxy)-5-(trifluoromethyl)aniline.
| Compound Name | 3-(3,3-dimethylbutoxy)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 82994867 |
| Molecular Formula | C13H18F3NO |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3-(3,3-dimethylbutoxy)-5-(trifluoromethyl)aniline |
| SMILES | CC(C)(C)CCOc1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3NO/c1-12(2,3)4-5-18-11-7-9(13(14,15)16)6-10(17)8-11/h6-8H,4-5,17H2,1-3H3 |
| InChIKey | DXBJQNCLMYWITF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|