C14H10Cl2F3N3S — CID 169367812
2-chloro-N'-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]ethanimidamide (PubChem CID 169367812) has the molecular formula C14H10Cl2F3N3S and a molecular weight of 380.22 g/mol. Its IUPAC name is 2-chloro-N'-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169367812 |
| Molecular Formula | C14H10Cl2F3N3S |
| Molecular Weight | 380.22 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 2-chloro-N'-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]phenyl]ethanimidamide |
| SMILES | N/C(CCl)=N/c1ccc(Sc2ncc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C14H10Cl2F3N3S/c15-6-12(20)22-9-1-3-10(4-2-9)23-13-11(16)5-8(7-21-13)14(17,18)19/h1-5,7H,6H2,(H2,20,22) |
| InChIKey | DPFZMHOXTGBRBF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.22 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|