C18H16Cl2N4O5S2 — CID 74228383
3,5-dichloro-N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-2-hydroxybenzenesulfonamide (PubChem CID 74228383) has the molecular formula C18H16Cl2N4O5S2 and a molecular weight of 503.39 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-2-hydroxybenzenesulfonamide.
| Compound Name | 3,5-dichloro-N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 74228383 |
| Molecular Formula | C18H16Cl2N4O5S2 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 501.99 |
| IUPAC Name | 3,5-dichloro-N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-2-hydroxybenzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NS(=O)(=O)c3cc(Cl)cc(Cl)c3O)cc2)nc(C)n1 |
| InChI | InChI=1S/C18H16Cl2N4O5S2/c1-10-7-17(22-11(2)21-10)24-30(26,27)14-5-3-13(4-6-14)23-31(28,29)16-9-12(19)8-15(20)18(16)25/h3-9,23,25H,1-2H3,(H,21,22,24) |
| InChIKey | VDXYNSPHUBREDE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 138.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|