About 5-(morpholin-4-yldiazenyl)benzene-1,3-dicarbonitrile
5-(morpholin-4-yldiazenyl)benzene-1,3-dicarbonitrile (PubChem CID 54043988) has the molecular formula C12H11N5O
and a molecular weight of 241.25 g/mol. Its IUPAC name is 5-(morpholin-4-yldiazenyl)benzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5-(morpholin-4-yldiazenyl)benzene-1,3-dicarbonitrile |
| PubChem CID | 54043988 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 5-(morpholin-4-yldiazenyl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(/N=N/N2CCOCC2)c1 |
| InChI | InChI=1S/C12H11N5O/c13-8-10-5-11(9-14)7-12(6-10)15-16-17-1-3-18-4-2-17/h5-7H,1-4H2/b16-15+ |
| InChIKey | LOGVNOWBHHGWCH-FOCLMDBBSA-N |
| XLogP | 1.76 |
| TPSA | 84.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(morpholin-4-yldiazenyl)benzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(morpholin-4-yldiazenyl)benzene-1,3-dicarbonitrile?
The IUPAC name of 5-(morpholin-4-yldiazenyl)benzene-1,3-dicarbonitrile (CID 54043988) is 5-(morpholin-4-yldiazenyl)benzene-1,3-dicarbonitrile.
What is the SMILES notation for 5-(morpholin-4-yldiazenyl)benzene-1,3-dicarbonitrile?
The canonical SMILES for 5-(morpholin-4-yldiazenyl)benzene-1,3-dicarbonitrile is N#Cc1cc(C#N)cc(/N=N/N2CCOCC2)c1.
What is the InChIKey of 5-(morpholin-4-yldiazenyl)benzene-1,3-dicarbonitrile?
The InChIKey is LOGVNOWBHHGWCH-FOCLMDBBSA-N. The full InChI is InChI=1S/C12H11N5O/c13-8-10-5-11(9-14)7-12(6-10)15-16-17-1-3-18-4-2-17/h5-7H,1-4H2/b16-15+.
What are the key properties of 5-(morpholin-4-yldiazenyl)benzene-1,3-dicarbonitrile?
5-(morpholin-4-yldiazenyl)benzene-1,3-dicarbonitrile has a molecular weight of 241.25 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(morpholin-4-yldiazenyl)benzene-1,3-dicarbonitrile is sourced from PubChem (CID 54043988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).