C42H42N6O6 — CID 15447864
5-[3-[[16-[[5-(3,5-dicyanophenyl)-2-hydroxyphenyl]methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]-4-hydroxyphenyl]benzene-1,3-dicarbonitrile (PubChem CID 15447864) has the molecular formula C42H42N6O6 and a molecular weight of 726.83 g/mol. Its IUPAC name is 5-[3-[[16-[[5-(3,5-dicyanophenyl)-2-hydroxyphenyl]methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]-4-hydroxyphenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[3-[[16-[[5-(3,5-dicyanophenyl)-2-hydroxyphenyl]methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]-4-hydroxyphenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 15447864 |
| Molecular Formula | C42H42N6O6 |
| Molecular Weight | 726.83 g/mol |
| Exact Mass | 726.32 |
| IUPAC Name | 5-[3-[[16-[[5-(3,5-dicyanophenyl)-2-hydroxyphenyl]methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]-4-hydroxyphenyl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(-c2ccc(O)c(CN3CCOCCOCCN(Cc4cc(-c5cc(C#N)cc(C#N)c5)ccc4O)CCOCCOCC3)c2)c1 |
| InChI | InChI=1S/C42H42N6O6/c43-25-31-17-32(26-44)20-37(19-31)35-1-3-41(49)39(23-35)29-47-5-9-51-13-15-53-11-7-48(8-12-54-16-14-52-10-6-47)30-40-24-36(2-4-42(40)50)38-21-33(27-45)18-34(22-38)28-46/h1-4,17-24,49-50H,5-16,29-30H2 |
| InChIKey | AHZZXGIJORFOLX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 179.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.83 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|