C30H39N3O6 — CID 122195666
3-[4-hydroxy-3-(morpholin-4-ylmethyl)phenyl]-6,8-bis(morpholin-4-ylmethyl)-2H-chromen-7-ol (PubChem CID 122195666) has the molecular formula C30H39N3O6 and a molecular weight of 537.66 g/mol. Its IUPAC name is 3-[4-hydroxy-3-(morpholin-4-ylmethyl)phenyl]-6,8-bis(morpholin-4-ylmethyl)-2H-chromen-7-ol.
| Compound Name | 3-[4-hydroxy-3-(morpholin-4-ylmethyl)phenyl]-6,8-bis(morpholin-4-ylmethyl)-2H-chromen-7-ol |
|---|---|
| PubChem CID | 122195666 |
| Molecular Formula | C30H39N3O6 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | 3-[4-hydroxy-3-(morpholin-4-ylmethyl)phenyl]-6,8-bis(morpholin-4-ylmethyl)-2H-chromen-7-ol |
| SMILES | Oc1ccc(C2=Cc3cc(CN4CCOCC4)c(O)c(CN4CCOCC4)c3OC2)cc1CN1CCOCC1 |
| InChI | InChI=1S/C30H39N3O6/c34-28-2-1-22(15-24(28)18-31-3-9-36-10-4-31)26-17-23-16-25(19-32-5-11-37-12-6-32)29(35)27(30(23)39-21-26)20-33-7-13-38-14-8-33/h1-2,15-17,34-35H,3-14,18-21H2 |
| InChIKey | YXTJEEVXJXQDRC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|