C19H31N3O2 — CID 170870620
2-[(4-methylpiperazin-1-yl)methyl]-4-(3-morpholin-4-ylpropyl)phenol (PubChem CID 170870620) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-[(4-methylpiperazin-1-yl)methyl]-4-(3-morpholin-4-ylpropyl)phenol.
| Compound Name | 2-[(4-methylpiperazin-1-yl)methyl]-4-(3-morpholin-4-ylpropyl)phenol |
|---|---|
| PubChem CID | 170870620 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 2-[(4-methylpiperazin-1-yl)methyl]-4-(3-morpholin-4-ylpropyl)phenol |
| SMILES | CN1CCN(Cc2cc(CCCN3CCOCC3)ccc2O)CC1 |
| InChI | InChI=1S/C19H31N3O2/c1-20-7-9-22(10-8-20)16-18-15-17(4-5-19(18)23)3-2-6-21-11-13-24-14-12-21/h4-5,15,23H,2-3,6-14,16H2,1H3 |
| InChIKey | PTQWRLDULCMMGT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|