C20H23N3O — CID 177392936
morpholin-4-yl(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)diazene (PubChem CID 177392936) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is morpholin-4-yl(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)diazene.
| Compound Name | morpholin-4-yl(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)diazene |
|---|---|
| PubChem CID | 177392936 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | morpholin-4-yl(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)diazene |
| SMILES | c1cc2ccc1CCc1ccc(c(/N=N/N3CCOCC3)c1)CC2 |
| InChI | InChI=1S/C20H23N3O/c1-3-17-4-2-16(1)5-6-18-8-10-19(9-7-17)20(15-18)21-22-23-11-13-24-14-12-23/h1-4,8,10,15H,5-7,9,11-14H2/b22-21+ |
| InChIKey | CPJOLKKEWHPCPY-QURGRASLSA-N |
| XLogP | 3.90 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|