C21H24N4O2 — CID 160604648
4-(morpholin-4-yliminomethyl)-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)benzamide (PubChem CID 160604648) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-(morpholin-4-yliminomethyl)-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)benzamide.
| Compound Name | 4-(morpholin-4-yliminomethyl)-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)benzamide |
|---|---|
| PubChem CID | 160604648 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-(morpholin-4-yliminomethyl)-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)CCNC2)c1ccc(C=NN2CCOCC2)cc1 |
| InChI | InChI=1S/C21H24N4O2/c26-21(24-20-6-5-19-15-22-8-7-18(19)13-20)17-3-1-16(2-4-17)14-23-25-9-11-27-12-10-25/h1-6,13-14,22H,7-12,15H2,(H,24,26) |
| InChIKey | NPUFKSNYKBDFLF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|