C25H30N4O3 — CID 70090907
2-[6-[[4-[(4-methylpiperazin-1-yl)iminomethyl]benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid (PubChem CID 70090907) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[6-[[4-[(4-methylpiperazin-1-yl)iminomethyl]benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-[[4-[(4-methylpiperazin-1-yl)iminomethyl]benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 70090907 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 2-[6-[[4-[(4-methylpiperazin-1-yl)iminomethyl]benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid |
| SMILES | CN1CCN(N=Cc2ccc(C(=O)Nc3ccc4c(c3)CCC(CC(=O)O)C4)cc2)CC1 |
| InChI | InChI=1S/C25H30N4O3/c1-28-10-12-29(13-11-28)26-17-18-2-5-20(6-3-18)25(32)27-23-9-8-21-14-19(15-24(30)31)4-7-22(21)16-23/h2-3,5-6,8-9,16-17,19H,4,7,10-15H2,1H3,(H,27,32)(H,30,31) |
| InChIKey | XLQASSJRIDDHDB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|