C32H43N3O3S — CID 70077922
octyl 2-[6-[[4-(thiomorpholin-4-yliminomethyl)phenyl]carbamoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate (PubChem CID 70077922) has the molecular formula C32H43N3O3S and a molecular weight of 549.78 g/mol. Its IUPAC name is octyl 2-[6-[[4-(thiomorpholin-4-yliminomethyl)phenyl]carbamoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate.
| Compound Name | octyl 2-[6-[[4-(thiomorpholin-4-yliminomethyl)phenyl]carbamoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 70077922 |
| Molecular Formula | C32H43N3O3S |
| Molecular Weight | 549.78 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | octyl 2-[6-[[4-(thiomorpholin-4-yliminomethyl)phenyl]carbamoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
| SMILES | CCCCCCCCOC(=O)CC1CCc2cc(C(=O)Nc3ccc(C=NN4CCSCC4)cc3)ccc2C1 |
| InChI | InChI=1S/C32H43N3O3S/c1-2-3-4-5-6-7-18-38-31(36)22-26-8-11-28-23-29(13-12-27(28)21-26)32(37)34-30-14-9-25(10-15-30)24-33-35-16-19-39-20-17-35/h9-10,12-15,23-24,26H,2-8,11,16-22H2,1H3,(H,34,37) |
| InChIKey | QFRUJOIYZMMDPL-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.78 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|