C27H33N3O4S — CID 70078256
butyl 2-[7-[[4-(thiomorpholin-4-yliminomethyl)benzoyl]amino]-3,4-dihydro-2H-chromen-3-yl]acetate (PubChem CID 70078256) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is butyl 2-[7-[[4-(thiomorpholin-4-yliminomethyl)benzoyl]amino]-3,4-dihydro-2H-chromen-3-yl]acetate.
| Compound Name | butyl 2-[7-[[4-(thiomorpholin-4-yliminomethyl)benzoyl]amino]-3,4-dihydro-2H-chromen-3-yl]acetate |
|---|---|
| PubChem CID | 70078256 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | butyl 2-[7-[[4-(thiomorpholin-4-yliminomethyl)benzoyl]amino]-3,4-dihydro-2H-chromen-3-yl]acetate |
| SMILES | CCCCOC(=O)CC1COc2cc(NC(=O)c3ccc(C=NN4CCSCC4)cc3)ccc2C1 |
| InChI | InChI=1S/C27H33N3O4S/c1-2-3-12-33-26(31)16-21-15-23-8-9-24(17-25(23)34-19-21)29-27(32)22-6-4-20(5-7-22)18-28-30-10-13-35-14-11-30/h4-9,17-18,21H,2-3,10-16,19H2,1H3,(H,29,32) |
| InChIKey | SYCVUSMOCHKWMB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|