C27H33N3O5 — CID 70075938
2-methoxyethyl 2-[7-[[4-(piperidin-1-yliminomethyl)benzoyl]amino]-3,4-dihydro-2H-chromen-3-yl]acetate (PubChem CID 70075938) has the molecular formula C27H33N3O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is 2-methoxyethyl 2-[7-[[4-(piperidin-1-yliminomethyl)benzoyl]amino]-3,4-dihydro-2H-chromen-3-yl]acetate.
| Compound Name | 2-methoxyethyl 2-[7-[[4-(piperidin-1-yliminomethyl)benzoyl]amino]-3,4-dihydro-2H-chromen-3-yl]acetate |
|---|---|
| PubChem CID | 70075938 |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 2-methoxyethyl 2-[7-[[4-(piperidin-1-yliminomethyl)benzoyl]amino]-3,4-dihydro-2H-chromen-3-yl]acetate |
| SMILES | COCCOC(=O)CC1COc2cc(NC(=O)c3ccc(C=NN4CCCCC4)cc3)ccc2C1 |
| InChI | InChI=1S/C27H33N3O5/c1-33-13-14-34-26(31)16-21-15-23-9-10-24(17-25(23)35-19-21)29-27(32)22-7-5-20(6-8-22)18-28-30-11-3-2-4-12-30/h5-10,17-18,21H,2-4,11-16,19H2,1H3,(H,29,32) |
| InChIKey | TUYVGEHCIDEVGC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|