C30H39N3O5 — CID 19697921
heptyl 2-[6-[[4-[(E)-morpholin-4-yliminomethyl]benzoyl]amino]-3,4-dihydro-2H-chromen-3-yl]acetate (PubChem CID 19697921) has the molecular formula C30H39N3O5 and a molecular weight of 521.66 g/mol. Its IUPAC name is heptyl 2-[6-[[4-[(E)-morpholin-4-yliminomethyl]benzoyl]amino]-3,4-dihydro-2H-chromen-3-yl]acetate.
| Compound Name | heptyl 2-[6-[[4-[(E)-morpholin-4-yliminomethyl]benzoyl]amino]-3,4-dihydro-2H-chromen-3-yl]acetate |
|---|---|
| PubChem CID | 19697921 |
| Molecular Formula | C30H39N3O5 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | heptyl 2-[6-[[4-[(E)-morpholin-4-yliminomethyl]benzoyl]amino]-3,4-dihydro-2H-chromen-3-yl]acetate |
| SMILES | CCCCCCCOC(=O)CC1COc2ccc(NC(=O)c3ccc(/C=N/N4CCOCC4)cc3)cc2C1 |
| InChI | InChI=1S/C30H39N3O5/c1-2-3-4-5-6-15-37-29(34)19-24-18-26-20-27(11-12-28(26)38-22-24)32-30(35)25-9-7-23(8-10-25)21-31-33-13-16-36-17-14-33/h7-12,20-21,24H,2-6,13-19,22H2,1H3,(H,32,35)/b31-21+ |
| InChIKey | SILFQDZCSHBZPQ-NJZRLIGZSA-N |
| XLogP | 5.06 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|