C23H25N3O5 — CID 70076947
2-[6-[[4-(morpholin-4-yliminomethyl)phenyl]carbamoyl]-3,4-dihydro-2H-chromen-3-yl]acetic acid (PubChem CID 70076947) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-[6-[[4-(morpholin-4-yliminomethyl)phenyl]carbamoyl]-3,4-dihydro-2H-chromen-3-yl]acetic acid.
| Compound Name | 2-[6-[[4-(morpholin-4-yliminomethyl)phenyl]carbamoyl]-3,4-dihydro-2H-chromen-3-yl]acetic acid |
|---|---|
| PubChem CID | 70076947 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[6-[[4-(morpholin-4-yliminomethyl)phenyl]carbamoyl]-3,4-dihydro-2H-chromen-3-yl]acetic acid |
| SMILES | O=C(O)CC1COc2ccc(C(=O)Nc3ccc(C=NN4CCOCC4)cc3)cc2C1 |
| InChI | InChI=1S/C23H25N3O5/c27-22(28)12-17-11-19-13-18(3-6-21(19)31-15-17)23(29)25-20-4-1-16(2-5-20)14-24-26-7-9-30-10-8-26/h1-6,13-14,17H,7-12,15H2,(H,25,29)(H,27,28) |
| InChIKey | RRIFVUWVZGVRKI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|