C27H34N4O4 — CID 70078188
butyl 2-[7-[[4-(morpholin-4-yliminomethyl)benzoyl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]acetate (PubChem CID 70078188) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is butyl 2-[7-[[4-(morpholin-4-yliminomethyl)benzoyl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]acetate.
| Compound Name | butyl 2-[7-[[4-(morpholin-4-yliminomethyl)benzoyl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]acetate |
|---|---|
| PubChem CID | 70078188 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | butyl 2-[7-[[4-(morpholin-4-yliminomethyl)benzoyl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]acetate |
| SMILES | CCCCOC(=O)CN1CCc2ccc(NC(=O)c3ccc(C=NN4CCOCC4)cc3)cc2C1 |
| InChI | InChI=1S/C27H34N4O4/c1-2-3-14-35-26(32)20-30-11-10-22-8-9-25(17-24(22)19-30)29-27(33)23-6-4-21(5-7-23)18-28-31-12-15-34-16-13-31/h4-9,17-18H,2-3,10-16,19-20H2,1H3,(H,29,33) |
| InChIKey | VDSQEJVNUROJCI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|