C25H30N4O4 — CID 70076903
ethyl 2-[7-[[4-(morpholin-4-yliminomethyl)benzoyl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]acetate (PubChem CID 70076903) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is ethyl 2-[7-[[4-(morpholin-4-yliminomethyl)benzoyl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]acetate.
| Compound Name | ethyl 2-[7-[[4-(morpholin-4-yliminomethyl)benzoyl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]acetate |
|---|---|
| PubChem CID | 70076903 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | ethyl 2-[7-[[4-(morpholin-4-yliminomethyl)benzoyl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]acetate |
| SMILES | CCOC(=O)CN1CCc2ccc(NC(=O)c3ccc(C=NN4CCOCC4)cc3)cc2C1 |
| InChI | InChI=1S/C25H30N4O4/c1-2-33-24(30)18-28-10-9-20-7-8-23(15-22(20)17-28)27-25(31)21-5-3-19(4-6-21)16-26-29-11-13-32-14-12-29/h3-8,15-16H,2,9-14,17-18H2,1H3,(H,27,31) |
| InChIKey | BHXVGJGKZIADQI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|