C31H42N4O3S — CID 70076914
octyl 2-[7-[[4-(thiomorpholin-4-yliminomethyl)benzoyl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]acetate (PubChem CID 70076914) has the molecular formula C31H42N4O3S and a molecular weight of 550.77 g/mol. Its IUPAC name is octyl 2-[7-[[4-(thiomorpholin-4-yliminomethyl)benzoyl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]acetate.
| Compound Name | octyl 2-[7-[[4-(thiomorpholin-4-yliminomethyl)benzoyl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]acetate |
|---|---|
| PubChem CID | 70076914 |
| Molecular Formula | C31H42N4O3S |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | octyl 2-[7-[[4-(thiomorpholin-4-yliminomethyl)benzoyl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]acetate |
| SMILES | CCCCCCCCOC(=O)CN1CCc2ccc(NC(=O)c3ccc(C=NN4CCSCC4)cc3)cc2C1 |
| InChI | InChI=1S/C31H42N4O3S/c1-2-3-4-5-6-7-18-38-30(36)24-34-15-14-26-12-13-29(21-28(26)23-34)33-31(37)27-10-8-25(9-11-27)22-32-35-16-19-39-20-17-35/h8-13,21-22H,2-7,14-20,23-24H2,1H3,(H,33,37) |
| InChIKey | FRXUXGPABWMRTL-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|