C29H37N3O3 — CID 19697966
butyl 2-[7-[[4-[(E)-piperidin-1-yliminomethyl]phenyl]carbamoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate (PubChem CID 19697966) has the molecular formula C29H37N3O3 and a molecular weight of 475.63 g/mol. Its IUPAC name is butyl 2-[7-[[4-[(E)-piperidin-1-yliminomethyl]phenyl]carbamoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate.
| Compound Name | butyl 2-[7-[[4-[(E)-piperidin-1-yliminomethyl]phenyl]carbamoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 19697966 |
| Molecular Formula | C29H37N3O3 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | butyl 2-[7-[[4-[(E)-piperidin-1-yliminomethyl]phenyl]carbamoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1CCc2ccc(C(=O)Nc3ccc(/C=N/N4CCCCC4)cc3)cc2C1 |
| InChI | InChI=1S/C29H37N3O3/c1-2-3-17-35-28(33)19-23-7-10-24-11-12-25(20-26(24)18-23)29(34)31-27-13-8-22(9-14-27)21-30-32-15-5-4-6-16-32/h8-9,11-14,20-21,23H,2-7,10,15-19H2,1H3,(H,31,34)/b30-21+ |
| InChIKey | VIVHEWWTSXAHRH-MWAVMZGNSA-N |
| XLogP | 5.60 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|