C26H31N3O3 — CID 70079029
methyl 2-[6-[[4-(piperidin-1-yliminomethyl)benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate (PubChem CID 70079029) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is methyl 2-[6-[[4-(piperidin-1-yliminomethyl)benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate.
| Compound Name | methyl 2-[6-[[4-(piperidin-1-yliminomethyl)benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 70079029 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | methyl 2-[6-[[4-(piperidin-1-yliminomethyl)benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetate |
| SMILES | COC(=O)CC1CCc2cc(NC(=O)c3ccc(C=NN4CCCCC4)cc3)ccc2C1 |
| InChI | InChI=1S/C26H31N3O3/c1-32-25(30)16-20-7-10-23-17-24(12-11-22(23)15-20)28-26(31)21-8-5-19(6-9-21)18-27-29-13-3-2-4-14-29/h5-6,8-9,11-12,17-18,20H,2-4,7,10,13-16H2,1H3,(H,28,31) |
| InChIKey | MAMAMWYHEPSVOD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|