C32H36N4O3 — CID 70077513
2-[1-ethyl-7-[[4-[(4-phenylpiperazin-1-yl)iminomethyl]benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid (PubChem CID 70077513) has the molecular formula C32H36N4O3 and a molecular weight of 524.67 g/mol. Its IUPAC name is 2-[1-ethyl-7-[[4-[(4-phenylpiperazin-1-yl)iminomethyl]benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid.
| Compound Name | 2-[1-ethyl-7-[[4-[(4-phenylpiperazin-1-yl)iminomethyl]benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 70077513 |
| Molecular Formula | C32H36N4O3 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | 2-[1-ethyl-7-[[4-[(4-phenylpiperazin-1-yl)iminomethyl]benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid |
| SMILES | CCC1c2cc(NC(=O)c3ccc(C=NN4CCN(c5ccccc5)CC4)cc3)ccc2CCC1CC(=O)O |
| InChI | InChI=1S/C32H36N4O3/c1-2-29-26(20-31(37)38)13-12-24-14-15-27(21-30(24)29)34-32(39)25-10-8-23(9-11-25)22-33-36-18-16-35(17-19-36)28-6-4-3-5-7-28/h3-11,14-15,21-22,26,29H,2,12-13,16-20H2,1H3,(H,34,39)(H,37,38) |
| InChIKey | BHFUWFBTMNWIDC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|