C26H31N3O3S — CID 70074965
2-[1-ethyl-6-[[4-(thiomorpholin-4-yliminomethyl)benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid (PubChem CID 70074965) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is 2-[1-ethyl-6-[[4-(thiomorpholin-4-yliminomethyl)benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid.
| Compound Name | 2-[1-ethyl-6-[[4-(thiomorpholin-4-yliminomethyl)benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 70074965 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 2-[1-ethyl-6-[[4-(thiomorpholin-4-yliminomethyl)benzoyl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid |
| SMILES | CCC1c2ccc(NC(=O)c3ccc(C=NN4CCSCC4)cc3)cc2CCC1CC(=O)O |
| InChI | InChI=1S/C26H31N3O3S/c1-2-23-21(16-25(30)31)8-7-20-15-22(9-10-24(20)23)28-26(32)19-5-3-18(4-6-19)17-27-29-11-13-33-14-12-29/h3-6,9-10,15,17,21,23H,2,7-8,11-14,16H2,1H3,(H,28,32)(H,30,31) |
| InChIKey | ZCIHMPVKVBFURV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|