C25H30N4O3 — CID 70089085
2-[6-[[4-(4-methylpiperazine-1-carboximidoyl)phenyl]carbamoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid (PubChem CID 70089085) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[6-[[4-(4-methylpiperazine-1-carboximidoyl)phenyl]carbamoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-[[4-(4-methylpiperazine-1-carboximidoyl)phenyl]carbamoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 70089085 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 2-[6-[[4-(4-methylpiperazine-1-carboximidoyl)phenyl]carbamoyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid |
| SMILES | [H]/N=C(/c1ccc(NC(=O)c2ccc3c(c2)CCC(CC(=O)O)C3)cc1)N1CCN(C)CC1 |
| InChI | InChI=1S/C25H30N4O3/c1-28-10-12-29(13-11-28)24(26)18-6-8-22(9-7-18)27-25(32)21-5-4-19-14-17(15-23(30)31)2-3-20(19)16-21/h4-9,16-17,26H,2-3,10-15H2,1H3,(H,27,32)(H,30,31)/b26-24- |
| InChIKey | IXCSSFQJXGVVEZ-LCUIJRPUSA-N |
| XLogP | 3.09 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|