C19H20N4O3 — CID 19048934
2-[7-[(4-carbamimidoylphenyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]acetic acid (PubChem CID 19048934) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[7-[(4-carbamimidoylphenyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]acetic acid.
| Compound Name | 2-[7-[(4-carbamimidoylphenyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]acetic acid |
|---|---|
| PubChem CID | 19048934 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-[7-[(4-carbamimidoylphenyl)carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2ccc3c(c2)CN(CC(=O)O)CC3)cc1 |
| InChI | InChI=1S/C19H20N4O3/c20-18(21)13-3-5-16(6-4-13)22-19(26)14-2-1-12-7-8-23(11-17(24)25)10-15(12)9-14/h1-6,9H,7-8,10-11H2,(H3,20,21)(H,22,26)(H,24,25) |
| InChIKey | MHNZCNRVZSNYAA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|