C24H29N7O — CID 165117950
2-carbamimidoyl-N-[4-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-3-methylphenyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide (PubChem CID 165117950) has the molecular formula C24H29N7O and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-carbamimidoyl-N-[4-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-3-methylphenyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide.
| Compound Name | 2-carbamimidoyl-N-[4-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-3-methylphenyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 165117950 |
| Molecular Formula | C24H29N7O |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 2-carbamimidoyl-N-[4-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-3-methylphenyl]-3,4-dihydro-1H-isoquinoline-7-carboxamide |
| SMILES | [H]/N=C(\N)N1CC=C(c2ccc(NC(=O)c3ccc4c(c3)CN(/C(N)=N/[H])CC4)cc2C)CC1 |
| InChI | InChI=1S/C24H29N7O/c1-15-12-20(4-5-21(15)17-7-9-30(10-8-17)23(25)26)29-22(32)18-3-2-16-6-11-31(24(27)28)14-19(16)13-18/h2-5,7,12-13H,6,8-11,14H2,1H3,(H3,25,26)(H3,27,28)(H,29,32) |
| InChIKey | YOXRUYSXXSGLDJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 135.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|