C21H25N7O — CID 165118952
4-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-N-[4-(diaminomethylideneamino)phenyl]-2-methylbenzamide (PubChem CID 165118952) has the molecular formula C21H25N7O and a molecular weight of 391.48 g/mol. Its IUPAC name is 4-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-N-[4-(diaminomethylideneamino)phenyl]-2-methylbenzamide.
| Compound Name | 4-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-N-[4-(diaminomethylideneamino)phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 165118952 |
| Molecular Formula | C21H25N7O |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 4-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-N-[4-(diaminomethylideneamino)phenyl]-2-methylbenzamide |
| SMILES | [H]/N=C(\N)N1CC=C(c2ccc(C(=O)Nc3ccc(N=C(N)N)cc3)c(C)c2)CC1 |
| InChI | InChI=1S/C21H25N7O/c1-13-12-15(14-8-10-28(11-9-14)21(24)25)2-7-18(13)19(29)26-16-3-5-17(6-4-16)27-20(22)23/h2-8,12H,9-11H2,1H3,(H3,24,25)(H,26,29)(H4,22,23,27) |
| InChIKey | SKJHQNHOYYUBFJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 146.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|