C20H23N5O — CID 165118090
N-[4-(diaminomethylideneamino)phenyl]-2-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide (PubChem CID 165118090) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is N-[4-(diaminomethylideneamino)phenyl]-2-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide.
| Compound Name | N-[4-(diaminomethylideneamino)phenyl]-2-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide |
|---|---|
| PubChem CID | 165118090 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | N-[4-(diaminomethylideneamino)phenyl]-2-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide |
| SMILES | Cc1cc(C2=CCNCC2)ccc1C(=O)Nc1ccc(N=C(N)N)cc1 |
| InChI | InChI=1S/C20H23N5O/c1-13-12-15(14-8-10-23-11-9-14)2-7-18(13)19(26)24-16-3-5-17(6-4-16)25-20(21)22/h2-8,12,23H,9-11H2,1H3,(H,24,26)(H4,21,22,25) |
| InChIKey | CRJBHFZHUPZERD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|