C28H28F7N3O5 — CID 175769556
N-[3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-2-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 175769556) has the molecular formula C28H28F7N3O5 and a molecular weight of 619.53 g/mol. Its IUPAC name is N-[3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-2-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-2-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 175769556 |
| Molecular Formula | C28H28F7N3O5 |
| Molecular Weight | 619.53 g/mol |
| Exact Mass | 619.19 |
| IUPAC Name | N-[3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-2-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1cc(C2=CCNCC2)ccc1C(=O)Nc1ccc(C2=CCNCC2)c(F)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H26FN3O.2C2HF3O2/c1-16-14-19(17-6-10-26-11-7-17)2-4-21(16)24(29)28-20-3-5-22(23(25)15-20)18-8-12-27-13-9-18;2*3-2(4,5)1(6)7/h2-6,8,14-15,26-27H,7,9-13H2,1H3,(H,28,29);2*(H,6,7) |
| InChIKey | REYOMFFHUZYTNE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |