C27H33FN6O — CID 165118361
3-fluoro-N-[3-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;(Z,3E)-3-hydrazinylideneprop-1-en-1-amine (PubChem CID 165118361) has the molecular formula C27H33FN6O and a molecular weight of 476.60 g/mol. Its IUPAC name is 3-fluoro-N-[3-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;(Z,3E)-3-hydrazinylideneprop-1-en-1-amine.
| Compound Name | 3-fluoro-N-[3-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;(Z,3E)-3-hydrazinylideneprop-1-en-1-amine |
|---|---|
| PubChem CID | 165118361 |
| Molecular Formula | C27H33FN6O |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 3-fluoro-N-[3-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;(Z,3E)-3-hydrazinylideneprop-1-en-1-amine |
| SMILES | Cc1cc(NC(=O)c2ccc(C3=CCNCC3)c(F)c2)ccc1C1=CCNCC1.N/C=C\C=N\N |
| InChI | InChI=1S/C24H26FN3O.C3H7N3/c1-16-14-20(3-5-21(16)17-6-10-26-11-7-17)28-24(29)19-2-4-22(23(25)15-19)18-8-12-27-13-9-18;4-2-1-3-6-5/h2-6,8,14-15,26-27H,7,9-13H2,1H3,(H,28,29);1-3H,4-5H2/b;2-1-,6-3+ |
| InChIKey | BSZJZUWFEVRMBN-CXFYMEROSA-N |
| XLogP | 3.54 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|