C24H25ClFN3O — CID 165118518
N-[3-chloro-2-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide (PubChem CID 165118518) has the molecular formula C24H25ClFN3O and a molecular weight of 425.94 g/mol. Its IUPAC name is N-[3-chloro-2-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide.
| Compound Name | N-[3-chloro-2-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide |
|---|---|
| PubChem CID | 165118518 |
| Molecular Formula | C24H25ClFN3O |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-[3-chloro-2-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide |
| SMILES | Cc1c(NC(=O)c2ccc(C3=CCNCC3)c(F)c2)ccc(C2=CCNCC2)c1Cl |
| InChI | InChI=1S/C24H25ClFN3O/c1-15-22(5-4-20(23(15)25)17-8-12-28-13-9-17)29-24(30)18-2-3-19(21(26)14-18)16-6-10-27-11-7-16/h2-6,8,14,27-28H,7,9-13H2,1H3,(H,29,30) |
| InChIKey | KLEWIHFEQMGPKQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |