C27H25Cl2F6N3O5 — CID 175769493
3-chloro-N-[3-chloro-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 175769493) has the molecular formula C27H25Cl2F6N3O5 and a molecular weight of 656.41 g/mol. Its IUPAC name is 3-chloro-N-[3-chloro-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-chloro-N-[3-chloro-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 175769493 |
| Molecular Formula | C27H25Cl2F6N3O5 |
| Molecular Weight | 656.41 g/mol |
| Exact Mass | 655.11 |
| IUPAC Name | 3-chloro-N-[3-chloro-4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(Nc1ccc(C2=CCNCC2)c(Cl)c1)c1ccc(C2=CCNCC2)c(Cl)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H23Cl2N3O.2C2HF3O2/c24-21-13-17(1-3-19(21)15-5-9-26-10-6-15)23(29)28-18-2-4-20(22(25)14-18)16-7-11-27-12-8-16;2*3-2(4,5)1(6)7/h1-5,7,13-14,26-27H,6,8-12H2,(H,28,29);2*(H,6,7) |
| InChIKey | IDTPDFFIBWENOQ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.41 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |