C27H32F2N4O3 — CID 167190429
tert-butyl 4-[2-fluoro-4-[[3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)benzoyl]amino]phenyl]piperazine-1-carboxylate (PubChem CID 167190429) has the molecular formula C27H32F2N4O3 and a molecular weight of 498.57 g/mol. Its IUPAC name is tert-butyl 4-[2-fluoro-4-[[3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)benzoyl]amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-fluoro-4-[[3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)benzoyl]amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167190429 |
| Molecular Formula | C27H32F2N4O3 |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | tert-butyl 4-[2-fluoro-4-[[3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)benzoyl]amino]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(NC(=O)c3ccc(C4=CCNCC4)c(F)c3)cc2F)CC1 |
| InChI | InChI=1S/C27H32F2N4O3/c1-27(2,3)36-26(35)33-14-12-32(13-15-33)24-7-5-20(17-23(24)29)31-25(34)19-4-6-21(22(28)16-19)18-8-10-30-11-9-18/h4-8,16-17,30H,9-15H2,1-3H3,(H,31,34) |
| InChIKey | XYEIUKNNCRWFKD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|