C25H33BFN3O4 — CID 165119035
CID 165119035 (PubChem CID 165119035) has the molecular formula C25H33BFN3O4 and a molecular weight of 469.37 g/mol.
| Compound Name | CID 165119035 |
|---|---|
| PubChem CID | 165119035 |
| Molecular Formula | C25H33BFN3O4 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | — |
| SMILES | CC.[B]c1ccc(NC(=O)c2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)c(F)c2)cc1OC |
| InChI | InChI=1S/C23H27BFN3O4.C2H6/c1-23(2,3)32-22(30)28-11-9-27(10-12-28)19-8-5-15(13-18(19)25)21(29)26-16-6-7-17(24)20(14-16)31-4;1-2/h5-8,13-14H,9-12H2,1-4H3,(H,26,29);1-2H3 |
| InChIKey | IWDNCVKNWNNTFM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|