C20H30FN5O3 — CID 70930820
tert-butyl 4-[4-[[(2R)-1-aminopyrrolidine-2-carbonyl]amino]-2-fluorophenyl]piperazine-1-carboxylate (PubChem CID 70930820) has the molecular formula C20H30FN5O3 and a molecular weight of 407.49 g/mol. Its IUPAC name is tert-butyl 4-[4-[[(2R)-1-aminopyrrolidine-2-carbonyl]amino]-2-fluorophenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[(2R)-1-aminopyrrolidine-2-carbonyl]amino]-2-fluorophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 70930820 |
| Molecular Formula | C20H30FN5O3 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | tert-butyl 4-[4-[[(2R)-1-aminopyrrolidine-2-carbonyl]amino]-2-fluorophenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(NC(=O)[C@H]3CCCN3N)cc2F)CC1 |
| InChI | InChI=1S/C20H30FN5O3/c1-20(2,3)29-19(28)25-11-9-24(10-12-25)16-7-6-14(13-15(16)21)23-18(27)17-5-4-8-26(17)22/h6-7,13,17H,4-5,8-12,22H2,1-3H3,(H,23,27)/t17-/m1/s1 |
| InChIKey | AEUMYLGRFJSOKC-QGZVFWFLSA-N |
| XLogP | 2.16 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|