C20H31FN4O4 — CID 176911930
tert-butyl 4-[4-[(2,6-dihydroxypiperidin-3-yl)amino]-2-fluorophenyl]piperazine-1-carboxylate (PubChem CID 176911930) has the molecular formula C20H31FN4O4 and a molecular weight of 410.49 g/mol. Its IUPAC name is tert-butyl 4-[4-[(2,6-dihydroxypiperidin-3-yl)amino]-2-fluorophenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(2,6-dihydroxypiperidin-3-yl)amino]-2-fluorophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176911930 |
| Molecular Formula | C20H31FN4O4 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | tert-butyl 4-[4-[(2,6-dihydroxypiperidin-3-yl)amino]-2-fluorophenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(NC3CCC(O)NC3O)cc2F)CC1 |
| InChI | InChI=1S/C20H31FN4O4/c1-20(2,3)29-19(28)25-10-8-24(9-11-25)16-6-4-13(12-14(16)21)22-15-5-7-17(26)23-18(15)27/h4,6,12,15,17-18,22-23,26-27H,5,7-11H2,1-3H3 |
| InChIKey | ZWCBWEZDHHHCPI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|