C20H31FN4O3 — CID 59144397
tert-butyl 4-[4-[[(2R)-2-amino-3-methylbutanoyl]amino]-2-fluorophenyl]piperazine-1-carboxylate (PubChem CID 59144397) has the molecular formula C20H31FN4O3 and a molecular weight of 394.49 g/mol. Its IUPAC name is tert-butyl 4-[4-[[(2R)-2-amino-3-methylbutanoyl]amino]-2-fluorophenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[(2R)-2-amino-3-methylbutanoyl]amino]-2-fluorophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59144397 |
| Molecular Formula | C20H31FN4O3 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | tert-butyl 4-[4-[[(2R)-2-amino-3-methylbutanoyl]amino]-2-fluorophenyl]piperazine-1-carboxylate |
| SMILES | CC(C)[C@@H](N)C(=O)Nc1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)c(F)c1 |
| InChI | InChI=1S/C20H31FN4O3/c1-13(2)17(22)18(26)23-14-6-7-16(15(21)12-14)24-8-10-25(11-9-24)19(27)28-20(3,4)5/h6-7,12-13,17H,8-11,22H2,1-5H3,(H,23,26)/t17-/m1/s1 |
| InChIKey | AKDARPNQIXAGBC-QGZVFWFLSA-N |
| XLogP | 2.80 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|