C23H27BrFN3O3 — CID 165119122
tert-butyl 4-[4-[(4-bromo-2-fluorobenzoyl)amino]-2-methylphenyl]piperazine-1-carboxylate (PubChem CID 165119122) has the molecular formula C23H27BrFN3O3 and a molecular weight of 492.39 g/mol. Its IUPAC name is tert-butyl 4-[4-[(4-bromo-2-fluorobenzoyl)amino]-2-methylphenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(4-bromo-2-fluorobenzoyl)amino]-2-methylphenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 165119122 |
| Molecular Formula | C23H27BrFN3O3 |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | tert-butyl 4-[4-[(4-bromo-2-fluorobenzoyl)amino]-2-methylphenyl]piperazine-1-carboxylate |
| SMILES | Cc1cc(NC(=O)c2ccc(Br)cc2F)ccc1N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H27BrFN3O3/c1-15-13-17(26-21(29)18-7-5-16(24)14-19(18)25)6-8-20(15)27-9-11-28(12-10-27)22(30)31-23(2,3)4/h5-8,13-14H,9-12H2,1-4H3,(H,26,29) |
| InChIKey | ISDPVIXXIXRSRM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|