C22H27N5O — CID 165118071
4-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-N-[4-[2-(methylamino)ethyl]phenyl]benzamide (PubChem CID 165118071) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-N-[4-[2-(methylamino)ethyl]phenyl]benzamide.
| Compound Name | 4-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-N-[4-[2-(methylamino)ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 165118071 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 4-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-N-[4-[2-(methylamino)ethyl]phenyl]benzamide |
| SMILES | [H]/N=C(\N)N1CC=C(c2ccc(C(=O)Nc3ccc(CCNC)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H27N5O/c1-25-13-10-16-2-8-20(9-3-16)26-21(28)19-6-4-17(5-7-19)18-11-14-27(15-12-18)22(23)24/h2-9,11,25H,10,12-15H2,1H3,(H3,23,24)(H,26,28) |
| InChIKey | RHMBZCSYWJEIMR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|