C30H40N8O2 — CID 166477135
N-[4-[(diaminomethylideneamino)methyl]phenyl]-4-formylbicyclo[2.2.1]heptane-1-carboxamide;4-[4-(methylamino)phenyl]-3,6-dihydro-2H-pyridine-1-carboximidamide (PubChem CID 166477135) has the molecular formula C30H40N8O2 and a molecular weight of 544.70 g/mol. Its IUPAC name is N-[4-[(diaminomethylideneamino)methyl]phenyl]-4-formylbicyclo[2.2.1]heptane-1-carboxamide;4-[4-(methylamino)phenyl]-3,6-dihydro-2H-pyridine-1-carboximidamide.
| Compound Name | N-[4-[(diaminomethylideneamino)methyl]phenyl]-4-formylbicyclo[2.2.1]heptane-1-carboxamide;4-[4-(methylamino)phenyl]-3,6-dihydro-2H-pyridine-1-carboximidamide |
|---|---|
| PubChem CID | 166477135 |
| Molecular Formula | C30H40N8O2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | N-[4-[(diaminomethylideneamino)methyl]phenyl]-4-formylbicyclo[2.2.1]heptane-1-carboxamide;4-[4-(methylamino)phenyl]-3,6-dihydro-2H-pyridine-1-carboximidamide |
| SMILES | NC(N)=NCc1ccc(NC(=O)C23CCC(C=O)(CC2)C3)cc1.[H]/N=C(\N)N1CC=C(c2ccc(NC)cc2)CC1 |
| InChI | InChI=1S/C17H22N4O2.C13H18N4/c18-15(19)20-9-12-1-3-13(4-2-12)21-14(23)17-7-5-16(10-17,11-22)6-8-17;1-16-12-4-2-10(3-5-12)11-6-8-17(9-7-11)13(14)15/h1-4,11H,5-10H2,(H,21,23)(H4,18,19,20);2-6,16H,7-9H2,1H3,(H3,14,15) |
| InChIKey | OPAAZCTVAOWXFV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 175.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|