C20H25N7OS2 — CID 165118021
5-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-N-[4-[2-(diaminomethylideneamino)ethylsulfanyl]phenyl]thiophene-2-carboxamide (PubChem CID 165118021) has the molecular formula C20H25N7OS2 and a molecular weight of 443.60 g/mol. Its IUPAC name is 5-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-N-[4-[2-(diaminomethylideneamino)ethylsulfanyl]phenyl]thiophene-2-carboxamide.
| Compound Name | 5-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-N-[4-[2-(diaminomethylideneamino)ethylsulfanyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 165118021 |
| Molecular Formula | C20H25N7OS2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 5-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-N-[4-[2-(diaminomethylideneamino)ethylsulfanyl]phenyl]thiophene-2-carboxamide |
| SMILES | [H]/N=C(\N)N1CC=C(c2ccc(C(=O)Nc3ccc(SCCN=C(N)N)cc3)s2)CC1 |
| InChI | InChI=1S/C20H25N7OS2/c21-19(22)25-9-12-29-15-3-1-14(2-4-15)26-18(28)17-6-5-16(30-17)13-7-10-27(11-8-13)20(23)24/h1-7H,8-12H2,(H3,23,24)(H,26,28)(H4,21,22,25) |
| InChIKey | UDZHDQPAGURFBG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 146.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|