C22H23F6N3O5S2 — CID 175769521
N-[4-(2-aminoethylsulfanyl)phenyl]-5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 175769521) has the molecular formula C22H23F6N3O5S2 and a molecular weight of 587.56 g/mol. Its IUPAC name is N-[4-(2-aminoethylsulfanyl)phenyl]-5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[4-(2-aminoethylsulfanyl)phenyl]-5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 175769521 |
| Molecular Formula | C22H23F6N3O5S2 |
| Molecular Weight | 587.56 g/mol |
| Exact Mass | 587.10 |
| IUPAC Name | N-[4-(2-aminoethylsulfanyl)phenyl]-5-(1,2,3,6-tetrahydropyridin-4-yl)thiophene-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NCCSc1ccc(NC(=O)c2ccc(C3=CCNCC3)s2)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21N3OS2.2C2HF3O2/c19-9-12-23-15-3-1-14(2-4-15)21-18(22)17-6-5-16(24-17)13-7-10-20-11-8-13;2*3-2(4,5)1(6)7/h1-7,20H,8-12,19H2,(H,21,22);2*(H,6,7) |
| InChIKey | GLSSDKFNGKKZMW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |