C28H29F6N3O3S — CID 44527300
N-[[1-[[4-(dimethylamino)phenyl]methyl]pyrrolidin-3-yl]methyl]-4-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 44527300) has the molecular formula C28H29F6N3O3S and a molecular weight of 601.61 g/mol. Its IUPAC name is N-[[1-[[4-(dimethylamino)phenyl]methyl]pyrrolidin-3-yl]methyl]-4-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[1-[[4-(dimethylamino)phenyl]methyl]pyrrolidin-3-yl]methyl]-4-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44527300 |
| Molecular Formula | C28H29F6N3O3S |
| Molecular Weight | 601.61 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | N-[[1-[[4-(dimethylamino)phenyl]methyl]pyrrolidin-3-yl]methyl]-4-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)c1ccc(CN2CCC(CNC(=O)c3cc(-c4cccc(C(F)(F)F)c4)cs3)C2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H28F3N3OS.C2HF3O2/c1-31(2)23-8-6-18(7-9-23)15-32-11-10-19(16-32)14-30-25(33)24-13-21(17-34-24)20-4-3-5-22(12-20)26(27,28)29;3-2(4,5)1(6)7/h3-9,12-13,17,19H,10-11,14-16H2,1-2H3,(H,30,33);(H,6,7) |
| InChIKey | MPJJFPOHUZYHGA-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.61 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|