C19H16N4O5 — CID 67707227
2-[7-[(4-carbamimidoylbenzoyl)amino]-1-oxo-3,4-dihydroisoquinolin-2-yl]-2-oxoacetic acid (PubChem CID 67707227) has the molecular formula C19H16N4O5 and a molecular weight of 380.36 g/mol. Its IUPAC name is 2-[7-[(4-carbamimidoylbenzoyl)amino]-1-oxo-3,4-dihydroisoquinolin-2-yl]-2-oxoacetic acid.
| Compound Name | 2-[7-[(4-carbamimidoylbenzoyl)amino]-1-oxo-3,4-dihydroisoquinolin-2-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 67707227 |
| Molecular Formula | C19H16N4O5 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 2-[7-[(4-carbamimidoylbenzoyl)amino]-1-oxo-3,4-dihydroisoquinolin-2-yl]-2-oxoacetic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)Nc2ccc3c(c2)C(=O)N(C(=O)C(=O)O)CC3)cc1 |
| InChI | InChI=1S/C19H16N4O5/c20-15(21)11-1-3-12(4-2-11)16(24)22-13-6-5-10-7-8-23(18(26)19(27)28)17(25)14(10)9-13/h1-6,9H,7-8H2,(H3,20,21)(H,22,24)(H,27,28) |
| InChIKey | MEODTZCIYCNSHX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|