C21H17N3O5 — CID 70051041
ethyl 2-[7-[(4-cyanobenzoyl)amino]-1-oxo-3,4-dihydroisoquinolin-2-yl]-2-oxoacetate (PubChem CID 70051041) has the molecular formula C21H17N3O5 and a molecular weight of 391.38 g/mol. Its IUPAC name is ethyl 2-[7-[(4-cyanobenzoyl)amino]-1-oxo-3,4-dihydroisoquinolin-2-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[7-[(4-cyanobenzoyl)amino]-1-oxo-3,4-dihydroisoquinolin-2-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 70051041 |
| Molecular Formula | C21H17N3O5 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | ethyl 2-[7-[(4-cyanobenzoyl)amino]-1-oxo-3,4-dihydroisoquinolin-2-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N1CCc2ccc(NC(=O)c3ccc(C#N)cc3)cc2C1=O |
| InChI | InChI=1S/C21H17N3O5/c1-2-29-21(28)20(27)24-10-9-14-7-8-16(11-17(14)19(24)26)23-18(25)15-5-3-13(12-22)4-6-15/h3-8,11H,2,9-10H2,1H3,(H,23,25) |
| InChIKey | DUHMUHFNDAMNKG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|