C15H12N2O2 — CID 64792528
4-cyano-N-(3-hydroxy-4-methylphenyl)benzamide (PubChem CID 64792528) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is 4-cyano-N-(3-hydroxy-4-methylphenyl)benzamide.
| Compound Name | 4-cyano-N-(3-hydroxy-4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 64792528 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 4-cyano-N-(3-hydroxy-4-methylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(C#N)cc2)cc1O |
| InChI | InChI=1S/C15H12N2O2/c1-10-2-7-13(8-14(10)18)17-15(19)12-5-3-11(9-16)4-6-12/h2-8,18H,1H3,(H,17,19) |
| InChIKey | DQFJZKGJXYLQCO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |