C16H12F3N3O3S — CID 155551960
4-cyano-N-[3-methyl-4-(trifluoromethylsulfonylamino)phenyl]benzamide (PubChem CID 155551960) has the molecular formula C16H12F3N3O3S and a molecular weight of 383.35 g/mol. Its IUPAC name is 4-cyano-N-[3-methyl-4-(trifluoromethylsulfonylamino)phenyl]benzamide.
| Compound Name | 4-cyano-N-[3-methyl-4-(trifluoromethylsulfonylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 155551960 |
| Molecular Formula | C16H12F3N3O3S |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 4-cyano-N-[3-methyl-4-(trifluoromethylsulfonylamino)phenyl]benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(C#N)cc2)ccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H12F3N3O3S/c1-10-8-13(6-7-14(10)22-26(24,25)16(17,18)19)21-15(23)12-4-2-11(9-20)3-5-12/h2-8,22H,1H3,(H,21,23) |
| InChIKey | TVEMNXIDMJHFBK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |