C21H24N2O3 — CID 42423988
N-(1-acetyl-2,3-dihydroindol-5-yl)-4-butoxybenzamide (PubChem CID 42423988) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-(1-acetyl-2,3-dihydroindol-5-yl)-4-butoxybenzamide.
| Compound Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-4-butoxybenzamide |
|---|---|
| PubChem CID | 42423988 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-4-butoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc3c(c2)CCN3C(C)=O)cc1 |
| InChI | InChI=1S/C21H24N2O3/c1-3-4-13-26-19-8-5-16(6-9-19)21(25)22-18-7-10-20-17(14-18)11-12-23(20)15(2)24/h5-10,14H,3-4,11-13H2,1-2H3,(H,22,25) |
| InChIKey | QLNNWAPCCOMEMZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|