C23H34N4O2 — CID 142931385
N-(3-amino-4-pyrrolidin-1-ylphenyl)-4-butoxybenzamide;N-methylmethanamine (PubChem CID 142931385) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is N-(3-amino-4-pyrrolidin-1-ylphenyl)-4-butoxybenzamide;N-methylmethanamine.
| Compound Name | N-(3-amino-4-pyrrolidin-1-ylphenyl)-4-butoxybenzamide;N-methylmethanamine |
|---|---|
| PubChem CID | 142931385 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | N-(3-amino-4-pyrrolidin-1-ylphenyl)-4-butoxybenzamide;N-methylmethanamine |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(N3CCCC3)c(N)c2)cc1.CNC |
| InChI | InChI=1S/C21H27N3O2.C2H7N/c1-2-3-14-26-18-9-6-16(7-10-18)21(25)23-17-8-11-20(19(22)15-17)24-12-4-5-13-24;1-3-2/h6-11,15H,2-5,12-14,22H2,1H3,(H,23,25);3H,1-2H3 |
| InChIKey | BYXKTUCNUAZZQA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|