C20H25N3O3 — CID 28688985
N-(3-amino-4-morpholin-4-ylphenyl)-3-propoxybenzamide (PubChem CID 28688985) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(3-amino-4-morpholin-4-ylphenyl)-3-propoxybenzamide.
| Compound Name | N-(3-amino-4-morpholin-4-ylphenyl)-3-propoxybenzamide |
|---|---|
| PubChem CID | 28688985 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-(3-amino-4-morpholin-4-ylphenyl)-3-propoxybenzamide |
| SMILES | CCCOc1cccc(C(=O)Nc2ccc(N3CCOCC3)c(N)c2)c1 |
| InChI | InChI=1S/C20H25N3O3/c1-2-10-26-17-5-3-4-15(13-17)20(24)22-16-6-7-19(18(21)14-16)23-8-11-25-12-9-23/h3-7,13-14H,2,8-12,21H2,1H3,(H,22,24) |
| InChIKey | DGBJUXZRXSNIJH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|